PRODUCT Properties
| Melting point: | 203°C (dec.) |
| Density | 1.48±0.1 g/cm3(Predicted) |
| pka | pK2:4;pK3:7.85;pK4:15 (25°C) |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChIKey | VSSGEDASAZNGHS-IEDQNEBGSA-N |
| SMILES | C(O)(=O)C1=CC=CC=C1N/N=C(\N=N\C1=CC(S(O)(=O)=O)=CC=C1O)/C1=CC=CC=C1 |
| CAS DataBase Reference | 135-52-4(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 2-[[[(2-hydroxy-5-sulfophenyl)azo]phenylmethylene]hydrazino]- (135-52-4) |
Description and Uses
ZINCON is used as a sensitive reagent for the determination of zinc and mercury.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-36 |
| TSCA | TSCA listed |



