M6315235
Zinclactate , 98% , 16039-53-5
CAS NO.：16039-53-5
Empirical Formula: C6H10O6Zn
Molecular Weight: 243.53
MDL number: MFCD00054367
EINECS: 240-178-9
| Pack Size | Price | Stock | Quantity |
| 25g | RMB31.20 | In Stock |
|
| 100g | RMB78.40 | In Stock |
|
| 500g | RMB268.80 | In Stock |
|
| 2.5kg | RMB958.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >256°C (subl.) |
| Density | 1.65[at 20℃] |
| vapor pressure | 0Pa at 20℃ |
| storage temp. | 2-8°C |
| solubility | Water (Slightly) |
| form | Solid |
| pka | 8.51[at 20 ℃] |
| color | White to Off-White |
| Water Solubility | 48.2g/L at 20℃ |
| Cosmetics Ingredients Functions | DEODORANT |
| InChI | InChI=1S/2C3H5O3.Zn/c2*1-2(4)3(5)6;/h2*2H,1H3,(H,5,6);/q2*-1;+4/p-2 |
| InChIKey | VRTAAVXOETYMFZ-UHFFFAOYSA-L |
| SMILES | CC1C([O-][Zn+2]2([O-]C(=O)C(C)O2)O1)=O |
| LogP | 0 at 20℃ |
| CAS DataBase Reference | 16039-53-5(CAS DataBase Reference) |
| EPA Substance Registry System | Zinc, bis[2-(hydroxy-.kappa.O)propanoato-.kappa.O]-, (T-4)- (16039-53-5) |
Description and Uses
Hypnotic
Safety
| Symbol(GHS) |   GHS05,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H318-H410 |
| Precautionary statements | P280-P305+P351+P338-P310-P264-P270-P301+P312-P330-P501-P273-P391-P501 |
| Hazard Codes | Xi,N |
| Risk Statements | 36/37/38-50/53 |
| Safety Statements | 26-36-61 |
| RIDADR | UN3077 |
| WGK Germany | 3 |
| HazardClass | 9 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
