M7135858
Citreoviridin , ≥99% , 25425-12-1
| Pack Size | Price | Stock | Quantity |
| 5g | RMB8000.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 107-111℃ |
| Boiling point: | 444.62°C (rough estimate) |
| Density | 1.1271 (rough estimate) |
| refractive index | 1.4593 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO: 10 mg/ml; Ethanol: 10 mg/ml |
| form | Yellow to orange powder. |
| pka | 13.67±0.70(Predicted) |
| color | Light yellow to yellow |
| Stability: | Light Sensitive |
| InChI | InChI=1S/C23H30O6/c1-15(14-22(4)21(25)23(5,26)17(3)29-22)11-9-7-8-10-12-18-16(2)19(27-6)13-20(24)28-18/h7-14,17,21,25-26H,1-6H3/b8-7+,11-9+,12-10+,15-14+ |
| InChIKey | JLSVDPQAIKFBTO-USJRQALFSA-N |
| SMILES | C1(C)(/C=C(\C)/C=C/C=C/C=C/C2OC(C=C(OC)C=2C)=O)OC(C)C(O)(C)C1O |
Description and Uses
Citreoviridin is a mycotoxin isolated from several Penicillium species that has been shown to inhibit the mitochondrial ATP synthetase system. It inhibits soluble ATPase (KD = 4.1 μM), ADP-stimulated respiration in isolated rat liver mitochondria (KD = 0.15 μM), and ATP-driven reduction of NAD+ by succinate (KD = 2 μM). Citreoviridin has been used to target ectopic ATPase activity in cancer cells in order to modulate the metabolic activity associated with tumorigenesis.[Cayman Chemical]
Safety
| Symbol(GHS) |   GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H300-H311-H315-H319-H331-H335-H361 |
| Precautionary statements | P261-P264-P280-P301+P310-P305+P351+P338-P311 |
| Hazard Codes | T |
| Risk Statements | 63-23/24/25-36/37/38 |
| Safety Statements | 22-26-36/37/39-45 |
| RIDADR | 3172 |
| RTECS | UQ1235000 |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 29322090 |
