PRODUCT Properties
| Melting point: | 34.5-38.5 °C(lit.) |
| Boiling point: | 171-194 °C(Press: 2 Torr) |
| Density | 0.882±0.06 g/cm3(Predicted) |
| Flash point: | >230 °F |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 16.29±0.46(Predicted) |
| form | Low-Melting Solid |
| color | White to Off-White |
| Cosmetics Ingredients Functions | ANTISTATIC |
| Cosmetic Ingredient Review (CIR) | N-[3-(DIMETHYLAMINO)PROPYL]LAURAMIDE (3179-80-4) |
| InChI | InChI=1S/C17H36N2O/c1-4-5-6-7-8-9-10-11-12-14-17(20)18-15-13-16-19(2)3/h4-16H2,1-3H3,(H,18,20) |
| InChIKey | TWMFGCHRALXDAR-UHFFFAOYSA-N |
| SMILES | C(NCCCN(C)C)(=O)CCCCCCCCCCC |
| LogP | 4.561 (est) |
| Surface tension | 27.8mN/m at 1g/L and 20℃ |
| EPA Substance Registry System | Dodecanamide, N-[3-(dimethylamino)propyl]- (3179-80-4) |
Description and Uses
N-(3-(Dimethylamino)propyl)dodecanamide is used in the study of surface chemistry and colloids as a new surfactnt for hydrate anti-agglomeration in hydrocarbon flowlines and seabed oil capture.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 2 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |

![N-[3-(Dimethylamino)propyl]lauramide](https://img.chemicalbook.com/CAS/GIF/3179-80-4.gif)

![(Z)-(carboxymethyl)dimethyl-3-[(1-oxo-9-octadecenyl)amino]propylammonium hydroxide](https://img.chemicalbook.com/CAS/GIF/25054-76-6.gif)


