azido-PEG6-Acid , 95% , 361189-66-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB1760.00 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| storage temp. | Storage temp. 2-8°C |
| solubility | Soluble in Water, DMSO, DCM, DMF |
| form | Liquid |
| color | Colorless to light yellow |
| InChI | InChI=1S/C15H29N3O8/c16-18-17-2-4-22-6-8-24-10-12-26-14-13-25-11-9-23-7-5-21-3-1-15(19)20/h1-14H2,(H,19,20) |
| InChIKey | KQYQHDQBMAJDRL-UHFFFAOYSA-N |
| SMILES | C(OCCOCCC(=O)O)COCCOCCOCCOCCN=[N+]=[N-] |
Description and Uses
Azido-PEG6-acid is a aqueous soluble PEG linker containing an azide and a terminal carboxylic acid. The azide (N3) group can react with alkyne, BCN, DBCO via Click Chemistry to yield a stable triazole linkage. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond.
Azido-PEG6-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG6-acid is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P261-P271 |
| HS Code | 2942000090 |
