PRODUCT Properties
| Melting point: | 302-304°C |
| Boiling point: | 679.3±55.0 °C(Predicted) |
| Density | 1.912 |
| storage temp. | Hygroscopic, Refrigerator, under inert atmosphere |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated, Sonicated)) |
| pka | 6.47±0.40(Predicted) |
| form | Solid |
| color | Dark Yellow |
| InChI | InChI=1S/C15H10O8/c16-6-2-1-5(3-7(6)17)14-13(22)12(21)10-8(18)4-9(19)11(20)15(10)23-14/h1-4,16-20,22H |
| InChIKey | YRRAGUMVDQQZIY-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(O)C(O)=C2)OC2=C(O)C(O)=CC(O)=C2C(=O)C=1O |
| LogP | 1.160 (est) |
Description and Uses
3,5,7,8,3'',4''-Hexahydroxyflavone is a flavonoid found in H. sabdariffa and has diverse biological activities/properties. 3,5,7,8,3'',4''-Hexahydroxyflavone is the anxiolytic and antidepressant constituents of H. sabdariffa calyces.






