PRODUCT Properties
| Boiling point: | 141-147 °C(Press: 0.02 Torr) |
| Density | 1.214±0.06 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 7.70±0.50(Predicted) |
| form | Oil |
| color | Yellow to Light Brown |
| InChI | InChI=1S/C14H15ClN2/c1-10-3-2-8-17(10)14-6-7-16-13-9-11(15)4-5-12(13)14/h4-7,9-10H,2-3,8H2,1H3 |
| InChIKey | GYORBDCAYLXAIL-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=C(Cl)C=2)C(N2CCCC2C)=CC=1 |
Description and Uses
7-Chloro-4-(2-methyl-1-pyrrolidinyl)-quinoline is a Chloroquine (C380315), iimpurity. Chloroquine is used in the treatment of malaria and MDR-strains.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P280-P305+P351+P338 |
| Toxicity | LD50 intravenous in mouse: 56mg/kg |







