M7412952
Amino-PEG12-amine , 95% , 361543-12-6
CAS NO.:361543-12-6
Empirical Formula: C26H56N2O12
Molecular Weight: 588.73
MDL number: MFCD31704944
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB3328.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 621.3±50.0 °C(Predicted) |
| Density | 1.087±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, protect from light |
| solubility | Soluble in water, DMSO, DCM and DMF |
| pka | 9.04±0.10(Predicted) |
| form | Solid-Liquid Mixture |
| color | Colorless to off-white |
| InChI | InChI=1S/C26H56N2O12/c27-1-3-29-5-7-31-9-11-33-13-15-35-17-19-37-21-23-39-25-26-40-24-22-38-20-18-36-16-14-34-12-10-32-8-6-30-4-2-28/h1-28H2 |
| InChIKey | LBBOTXXNKBSUJN-UHFFFAOYSA-N |
| SMILES | C(N)COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN |
Description and Uses
H2N-PEG12-CH2CH2NH2 (CAS 361543-12-6), also known as Amino-PEG12-amine or NH2-PEG12-NH2, is a PEG linker containing two amino groups (NH₂). The hydrophilic PEG spacer enhances its solubility in aqueous media. Its amino groups can react with carboxylic acids, activated NHS esters, and carbonyl groups (ketones, aldehydes), amongst others.
Amino-PEG12-amine is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P302+P352-P304+P340-P330-P362+P364-P405-P501 |







