β-BoswellicAcid , 95% , 631-69-6
Synonym(s):
(3α,4β)-3-Hydroxyurs-12-en-23-oic acid;3α-Hydroxyurs-12-en-24-oic acid
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB2280.00 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 130-135°C |
| alpha | D +107° (c = 0.75 in CHCl3) |
| Boiling point: | 556.0±50.0 °C(Predicted) |
| Density | 1.09±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| pka | 4.50±0.70(Predicted) |
| form | Solid |
| color | Off-White |
| Water Solubility | practically insoluble in water |
| Major Application | food and beverages |
| InChIKey | NBGQZFQREPIKMG-AKOQEMLPSA-N |
| SMILES | C[C@@H]1CC[C@]2(C)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@@H](O)[C@@](C)([C@@H]5CC[C@@]34C)C(O)=O)[C@@H]2[C@H]1C |
| LogP | 9.105 (est) |
| CAS DataBase Reference | 631-69-6 |
Description and Uses
β-Boswellic acid is a pentacyclic triterpene originally isolated from Boswellia that has diverse bioactivities. It inhibits 5-lipoxygenase (5-LO) with an IC50 value of approximately 5 μM but is less potent than its derivative 3-acetyl-11-keto-β-boswellic acid . It inhibits cell proliferation in HL-60 cells with IC50 values of 3.7, 7.1, and 6.3 μM for DNA, RNA, and protein synthesis, respectively. In human umbilical vein endothelial cells (HUVECs) transiently deprived of oxygen and glucose, β-boswellic acid increases nitric oxide and increases phosphorylation of enzyme nitric oxide synthase (eNOS). It also increases calcium mobilization in platelets at concentrations ≥3 μM and induces platelet aggregation (EC50 = 8 μM).
The principal constitutents of frankincense (olibanum). A specific, nonredox inhibitor of 5-lipoxygenase used to treat inflammation.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |






