M7728040
9,9-Bis[4-(2-acryloyloxyethyloxy)phenyl]fluorene , 93%solid content, 5%-7%toluene , 161182-73-6
| Pack Size | Price | Stock | Quantity |
| 5g | RMB318.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 671.3±55.0 °C(Predicted) |
| Density | 1.208 |
| storage temp. | Amber Vial, Refrigerator, Under inert atmosphere |
| solubility | Chloroform (Sparingly), Methanol (Slightly, Heated, Sonicated) |
| form | Oil |
| color | Colourless |
| Stability: | Light Sensitive |
| InChIKey | YCPMSWJCWKUXRH-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(OCCOC(=O)C=C)C=C2)(C2=CC=C(OCCOC(=O)C=C)C=C2)C2=C(C=CC=C2)C2=C1C=CC=C2 |
| CAS DataBase Reference | 161182-73-6(CAS DataBase Reference) |
Description and Uses
(((9H-Fluorene-9,9-diyl)bis(4,1-phenylene))bis(oxy))bis(ethane-2,1-diyl) diacrylate (CAS# 161182-73-6) is a photosensitive compound often found in film curing resins and solutions.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |

![9,9-Bis[4-(2-acryloyloxyethyloxy)phenyl]fluorene](https://img.chemicalbook.com/CAS/GIF/161182-73-6.gif)


![9,9-Bis[4-(2-hydroxyethoxy)phenyl]fluorene](https://img.chemicalbook.com/CAS/GIF/117344-32-8.gif)
