PRODUCT Properties
| Melting point: | 89-91 °C |
| Boiling point: | 422.8±45.0 °C(Predicted) |
| Density | 1.203±0.06 g/cm3(Predicted) |
| storage temp. | Store at -20°C |
| form | Solid |
| pka | 8.45±0.20(Predicted) |
| color | White to yellow |
| InChI | InChI=1S/C14H14O3/c1-9(2)3-6-11-12(15)7-4-10-5-8-13(16)17-14(10)11/h3-5,7-8,15H,6H2,1-2H3 |
| InChIKey | RAKJVIPCCGXHHS-UHFFFAOYSA-N |
| SMILES | C1(=O)OC2=C(C/C=C(/C)\C)C(O)=CC=C2C=C1 |
| LogP | 3.342 (est) |
Description and Uses
Osthenol (Ostenol), a prenylated coumarin isolated from the dried roots of Angelica pubescens, is selective, reversible, and competitive human monoamine oxidase-A (hMAO-A) inhibitor (Ki=0.26 μM). Osthenol potently inhibits recombinant hMAO-A with an IC50 of 0.74 μM and shows a high selectivity index for hMAO-A versus hMAO-B[1].
