M7898147
Prohexadionecalcium , ≥99% , 127277-53-6
Synonym(s):
3,5-Dioxo-4-propionyl-cyclohexanecarboxylic acid calcium salt
CAS NO.:127277-53-6
Empirical Formula: C10H13Ca2O5+
Molecular Weight: 293.36
MDL number: MFCD01752177
EINECS: 200-001-8
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB345.60 | In Stock |
|
| 250mg | RMB1064.00 | In Stock |
|
| 1g | RMB3104.00 | In Stock |
|
| 5g | RMB8480.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >360° |
| storage temp. | 0-6°C |
| form | Solid |
| color | Off-white to light yellow |
| Henry's Law Constant | 5.2×104 mol/(m3Pa) at 25℃, Maniere et al. (2011) |
| Major Application | agriculture environmental |
| InChI | InChI=1S/C10H11O5.2Ca.2H/c1-2-6(11)9-7(12)3-5(10(14)15)4-8(9)13;;;;/h5H,2-4H2,1H3,(H,14,15);;;;/q-1;;+2;; |
| InChIKey | MRNFLMSOYSDUNU-UHFFFAOYSA-N |
| SMILES | C([C-]1C(CC(C(=O)O)CC1=O)=O)(=O)CC.[Ca+2].[Ca] |
| EPA Substance Registry System | Prohexadione calcium (127277-53-6) |
Description and Uses
Prohexadione-Calcium (Pro-Ca, prohexadione-Ca or BX-112) is a plant growth retardant which is used to inhibit gibberellin biosynthesis of plants. It generally reduces shoot elongation in plants.
Prohexadione Calcium is a plant growth regulator.
Safety
| Symbol(GHS) | ![]() GHS09 |
| Hazard statements | H411-H412 |
| Precautionary statements | P273-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 2 |
| RTECS | GU8488500 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 127277-53-6(Hazardous Substances Data) |
| Toxicity | LD50 in rats (mg/kg): >5000 orally; >2000 dermally; LC50 in carp, bluegill sunfish, rainbow trout (mg/l): >150, >100, >100 (Miyazawa) |



