M7960947
O-DesmethylGefitinib , 98% , 847949-49-9
CAS NO.:847949-49-9
Empirical Formula: C21H22ClFN4O3
Molecular Weight: 432.88
MDL number: MFCD09952182
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB1853.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 117-120C |
| storage temp. | -20°C Freezer |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Yellow |
| biological source | synthetic |
| Stability: | Hygroscopic |
| InChI | 1S/C21H22ClFN4O3/c22-16-10-14(2-3-17(16)23)26-21-15-11-20(19(28)12-18(15)24-13-25-21)30-7-1-4-27-5-8-29-9-6-27/h2-3,10-13,28H,1,4-9H2,(H,24,25,26) |
| InChIKey | IFMMYZUUCFPEHR-UHFFFAOYSA-N |
| SMILES | Fc1c(cc(cc1)Nc2ncnc3c2cc(c(c3)O)OCCCN4CCOCC4)Cl |
Description and Uses
O-Desmethyl Gefitinib-d8 is the isotope labelled analog of O-Desmethyl Gefitinib (D291680); a major metabolite of Gefitinib (G304000) which is an antineoplastic.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Safety Statements | 24/25 |
| WGK Germany | WGK 3 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







