M7990547
(+)-Warfarin , 98% , 5543-58-8
Synonym(s):
R-(+)-3-Acetonybenzyl)-4-hydroxycoumarin;R-(+)-4-Hydroxy-3-(3-oxo-1-phenybutyl)-2H-1-benzopyran-2-one
CAS NO.：5543-58-8
Empirical Formula: C19H16O4
Molecular Weight: 308.33
MDL number: MFCD00272376
EINECS: 226-908-9
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB5218.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ≥170 °C |
| Boiling point: | 515.2±50.0 °C(Predicted) |
| Density | 1.307±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMF: soluble |
| form | A crystalline solid |
| pka | 4.50±1.00(Predicted) |
| color | white to pale yellow |
| InChI | 1S/C19H16O4/c1-12(20)11-15(13-7-3-2-4-8-13)17-18(21)14-9-5-6-10-16(14)23-19(17)22/h2-10,15,21H,11H2,1H3/t15-/m1/s1 |
| InChIKey | PJVWKTKQMONHTI-OAHLLOKOSA-N |
| SMILES | [H][C@@](CC(C)=O)(c1ccccc1)C2=C(O)c3ccccc3OC2=O |
Description and Uses
The R-(+)-form of Warfarin (W498500). Coumarin anticoagulant.
Safety
| Symbol(GHS) |    GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330-H360D-H372-H411 |
| Precautionary statements | P202-P264-P273-P280-P302+P352+P310-P304+P340+P310 |
| target organs | Blood |
| Hazard Codes | T |
| Risk Statements | 61-48/25-52/53 |
| Safety Statements | 53-45-61 |
| RIDADR | UN 2811 6.1/PG 1 |
| WGK Germany | 3 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Dermal Acute Tox. 1 Inhalation Acute Tox. 2 Oral Aquatic Chronic 2 Repr. 1A STOT RE 1 |
