M8011947
Isocarboxazid , 98% , 59-63-2
Synonym(s):
5-Methyl-3-isoxazolecarboxylic acid 2-benzylhydrazide
CAS NO.：59-63-2
Empirical Formula: C12H13N3O2
Molecular Weight: 231.25
MDL number: MFCD00865409
EINECS: 200-438-4
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB1251.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 98-1000C |
| Boiling point: | 373.33°C (rough estimate) |
| Density | 1.206 |
| refractive index | 1.5290 (estimate) |
| storage temp. | -20°C Freezer |
| solubility | Acetonitrile: Slightly Soluble; Chloroform: Slightly Soluble |
| form | A solid |
| pka | pKa 10.4 (Uncertain) |
| color | White to off-white |
| Water Solubility | 0.8g/L(25 ºC) |
| InChI | 1S/C12H13N3O2/c1-9-7-11(15-17-9)12(16)14-13-8-10-5-3-2-4-6-10/h2-7,13H,8H2,1H3,(H,14,16) |
| InChIKey | XKFPYPQQHFEXRZ-UHFFFAOYSA-N |
| SMILES | Cc1cc(no1)C(=O)NNCc2ccccc2 |
Description and Uses
Isocarboxazid is a powerful MAO inhibitor. As with phenelzine, isocarboxazid is used for depressions that do not respond to other drugs.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P264-P270-P301+P310-P405-P501 |
| RIDADR | 3249 |
| WGK Germany | WGK 3 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 2934990002 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
