PRODUCT Properties
| Melting point: | 208-214 °C |
| Boiling point: | 557.6±50.0 °C(Predicted) |
| Density | 1.406±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | Soluble in ethanol;Soluble in DMSO;Soluble in dimethyl formamide |
| form | solid |
| pka | 2.97±0.34(Predicted) |
| color | white |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| InChI | 1S/C17H16O8/c1-8-4-11(19)14(16(20)21)12(5-8)25-15-10(17(22)24-3)6-9(18)7-13(15)23-2/h4-7,18-19H,1-3H3,(H,20,21) |
| InChIKey | XOKVHFNTYHPEHN-UHFFFAOYSA-N |
| SMILES | O(C)c1c(c(cc(c1)O)C(=O)OC)Oc2c(c(cc(c2)C)O)C(=O)O |
Description and Uses
Asterric acid is a fungal metabolite with anti-angiogenic properties, isolated from a number of Aspergillus and Penicillium species. It is an inhibitor of vascular endothelial growth factor (VEGF), inhibiting VEGF-induced tube formation of human umbilical vein endothelial cells.





