M8198247
Cyazofamid , 98% , 120116-88-3
Synonym(s):
4-Chloro-1-(dimethylaminosulfonyl)-5-(p-tolyl)imidazole-2-carbonitrile
CAS NO.:120116-88-3
Empirical Formula: C13H13ClN4O2S
Molecular Weight: 324.79
MDL number: MFCD04112761
EINECS: 601-671-8
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB2864.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 152.7° |
| Boiling point: | 498.2±37.0 °C(Predicted) |
| Density | 1.38±0.1 g/cm3(Predicted) |
| Flash point: | 4 °C |
| storage temp. | -20°C |
| solubility | DMF: 15 mg/ml; DMSO: 10 mg/ml |
| pka | -6.61±0.70(Predicted) |
| form | Solid |
| color | White to off-white |
| Major Application | agriculture environmental |
| InChI | InChI=1S/C13H13ClN4O2S/c1-9-4-6-10(7-5-9)12-13(14)16-11(8-15)18(12)21(19,20)17(2)3/h4-7H,1-3H3 |
| InChIKey | YXKMMRDKEKCERS-UHFFFAOYSA-N |
| SMILES | C1(C#N)N(S(N(C)C)(=O)=O)C(C2=CC=C(C)C=C2)=C(Cl)N=1 |
| LogP | 1.750 (est) |
| EPA Substance Registry System | Cyazofamid (120116-88-3) |
Description and Uses
Agricultural fungicide.
Safety
| Symbol(GHS) | ![]() GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273-P391-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | F,Xn,N |
| Risk Statements | 11-38-48/20-63-65-67-20/21/22-50/53-52/53 |
| Safety Statements | 36/37-62-36-61-60-16 |
| RIDADR | UN1294 3/PG 2 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |
| Hazardous Substances Data | 120116-88-3(Hazardous Substances Data) |
| Toxicity | LD50 orally in mice, rats: >5000, >5000 mg/kg; dermally in rats: >2000 mg/kg; LC50 in rats: >5.5 mg/l by inhalation; LC50 (48 hr) in carp, rainbow trout: >69.6, >100 mg/l (Mitani) |






