Conessine , 98% , 546-06-5
Synonym(s):
(3β)-N,N-dimethyl-con-5-enin-3-amine;Conessin;Neriine;Roquessine;Wrightine
CAS NO.:546-06-5
Empirical Formula: C24H40N2
Molecular Weight: 356.59
MDL number: MFCD00016752
EINECS: 208-897-2
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB1628.80 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 126-127°C |
| alpha | D20 +25.3° (c = 0.7 in abs alc) |
| Boiling point: | 479.38°C (rough estimate) |
| Density | 0.9492 (rough estimate) |
| refractive index | 1.5640 (estimate) |
| storage temp. | Store at RT |
| solubility | ethanol: ≥2mg/mL |
| form | powder |
| pka | 10.20±0.70(Predicted) |
| color | white to tan |
| optical activity | +25.320 (c 0.7, ethanol) |
| InChIKey | GPLGAQQQNWMVMM-MYAJQUOBSA-N |
| SMILES | C[C@H]1[C@H]2CC[C@H]3[C@@H]4CC=C5C[C@H](CC[C@]5(C)[C@H]4CC[C@]23CN1C)N(C)C |
| LogP | 6.060 (est) |
Description and Uses
Conessine is a naturally occurring steroid alkaloid found in a number of plant species from the Apocynaceae family, which have been used in traditional herbal medicine as a treatment for amoebic dysentery. In a radioligand-
antiamebic, antibacterial, antineoplastic, anesthetic (local)
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| RTECS | GK7621000 |
| HS Code | 2939799090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







