M8400655
7-Iodo-7-Deaza-2'',3''-dideoxyguanosine , 97% , 114748-67-3
CAS NO.：114748-67-3
Empirical Formula: C11H13IN4O3
Molecular Weight: 376.15
MDL number: MFCD28139111
EINECS: 500-100-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB8960.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 2.35±0.1 g/cm3(Predicted) |
| storage temp. | 4°C, protect from light |
| pka | 10.28±0.20(Predicted) |
| form | Solid |
| color | Off-white to light yellow |
| InChI | InChI=1S/C11H13IN4O3/c12-6-3-16(7-2-1-5(4-17)19-7)9-8(6)10(18)15-11(13)14-9/h3,5,7,17H,1-2,4H2,(H3,13,14,15,18)/t5-,7+/m0/s1 |
| InChIKey | KJNOBXXCZQLWLF-CAHLUQPWSA-N |
| SMILES | C1(N)NC(=O)C2C(I)=CN([C@H]3CC[C@@H](CO)O3)C=2N=1 |
Description and Uses
7-Iodo-2',3'-dideoxy-7-deaza-guanosine is a dideoxynucleoside that can be used in DNA synthesis and sequencing reactions[1].
