M9074034
Azlocillinsodiumsalt , 99% , 37091-65-9
Synonym(s):
D -α-([Imidazolidin-2-on-1-yl]carbonylamino)benzylpenicillin
CAS NO.：37091-65-9
Empirical Formula: C20H22N5NaO6S
Molecular Weight: 483.47
MDL number: MFCD07793330
EINECS: 253-347-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB132.80 | In Stock |
|
| 5g | RMB461.60 | In Stock |
|
| 25g | RMB1797.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >199oC (dec.) |
| Flash point: | >110°(230°F) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | H2O: soluble50mg/mL |
| form | powder |
| color | White to Off-White |
| Water Solubility | Freely soluble in water |
| Stability: | Hygroscopic |
| InChIKey | UVOCNBWUHNCKJM-CHNWLKQKNA-M |
| SMILES | N12C([C@@H](NC(=O)[C@H](NC(=O)N3CCNC3=O)C3=CC=CC=C3)[C@H]1SC(C)(C)[C@@H]2C([O-])=O)=O.[Na+] |&1:2,6,22,27,r| |
| CAS DataBase Reference | 37091-65-9(CAS DataBase Reference) |
Description and Uses
Antibacterial;Bacterial transpeptidase inhibitor
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Danger |
| Hazard statements | H317-H334 |
| Precautionary statements | P280-P302+P352 |
| Hazard Codes | Xn |
| Risk Statements | 42/43 |
| Safety Statements | 36 |
| WGK Germany | 3 |
| RTECS | XH9250000 |
| Toxicity | mouse,LD50,intramuscular,15420mg/kg (15420mg/kg),LUNGS, THORAX, OR RESPIRATION: DYSPNEABEHAVIORAL: TREMORBEHAVIORAL: ALTERED SLEEP TIME (INCLUDING CHANGE IN RIGHTING REFLEX),Antibiotiki i Meditsinskaya Biotekhnologiya. Antibiotics and Medical Biotechnology. Vol. 32, Pg. 453, 1987. |
