M9309534
ACETANILIDE-2,3,4,5,6-D5 , AR , 15826-91-2
Synonym(s):
N-(Phenyl-2,3,4,5,6-d5)acetamide
CAS NO.:15826-91-2
Empirical Formula: C8H4D5NO
Molecular Weight: 140.19
MDL number: MFCD00084103
EINECS: 239-928-8
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB1807.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 113-115 °C(lit.) |
| Boiling point: | 304 °C(lit.) |
| Density | 1.266 g/mL at 25 °C |
| storage temp. | -20°C Freezer |
| solubility | Chloroform (Slightly), Dichloromethane (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Pale Beige to Brown |
| InChI | InChI=1S/C8H9NO/c1-7(10)9-8-5-3-2-4-6-8/h2-6H,1H3,(H,9,10)/i2D,3D,4D,5D,6D |
| InChIKey | FZERHIULMFGESH-VIQYUKPQSA-N |
| SMILES | C1(NC(=O)C)=C([2H])C(=C([2H])C([2H])=C1[2H])[2H] |
| EPA Substance Registry System | Acetamide, N-(phenyl-d5)- (15826-91-2) |
Description and Uses
The first aniline derivative found to possess analgesic and antipyretic properties.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H302-H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P270-P301+P312-P330-P501-P264-P280-P305+P351+P338-P337+P313P |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 22-26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |





