PRODUCT Properties
| Melting point: | -55.5°C |
| Boiling point: | 98.55°C |
| Density | 1.2212 |
| refractive index | 1.4282 |
| solubility | soluble in Chloroform, Methanol, Toluene |
| form | Colourless to Light Yellow Solution |
| InChI | InChI=1S/C2H3NO2/c1-2-3(4)5/h2H,1H2 |
| InChIKey | RPMXALUWKZHYOV-UHFFFAOYSA-N |
| SMILES | C=C[N+]([O-])=O |
| CAS DataBase Reference | 3638-64-0 |
| NIST Chemistry Reference | Nitroethylene(3638-64-0) |
| EPA Substance Registry System | Ethene, nitro- (3638-64-0) |
Description and Uses
Nitroethylene is the simplest ntiroalkene and serves as a useful intermediate for the production of various chemicals and pharmaceutical goods.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
