PRODUCT Properties
Melting point: | -55.5°C |
Boiling point: | 98.55°C |
Density | 1.2212 |
refractive index | 1.4282 |
solubility | soluble in Chloroform, Methanol, Toluene |
form | Colourless to Light Yellow Solution |
InChI | InChI=1S/C2H3NO2/c1-2-3(4)5/h2H,1H2 |
InChIKey | RPMXALUWKZHYOV-UHFFFAOYSA-N |
SMILES | C=C[N+]([O-])=O |
CAS DataBase Reference | 3638-64-0 |
NIST Chemistry Reference | Nitroethylene(3638-64-0) |
EPA Substance Registry System | Ethene, nitro- (3638-64-0) |
Description and Uses
Nitroethylene is the simplest ntiroalkene and serves as a useful intermediate for the production of various chemicals and pharmaceutical goods.
Safety
Symbol(GHS) | ![]() GHS07 |
Signal word | Warning |
Hazard statements | H302-H315-H319-H335 |
Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |