M9522052
2,6-Diamino-4-chloropyrimidine1-oxide , 97% , 35139-67-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB310.40 | In Stock |
|
| 1g | RMB1024.00 | In Stock |
|
| 5g | RMB3999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 185 °C (dec.) (lit.) |
| Boiling point: | 506.5±53.0 °C(Predicted) |
| Density | 1.91±0.1 g/cm3(Predicted) |
| vapor pressure | 0.001Pa at 25℃ |
| storage temp. | 2-8°C, protect from light, stored under nitrogen |
| solubility | DMSO (Slightly), Dichloromethane (Slightly), Methanol (Slightly) |
| form | Solid:particulate/powder |
| pka | 1.67±0.10(Predicted) |
| Appearance | White to off-white Solid |
| Stability: | Light Sensitive |
| InChI | InChI=1S/C4H5ClN4O/c5-2-1-3(6)9(10)4(7)8-2/h1H,6H2,(H2,7,8) |
| InChIKey | CFHPTZFRFWGDPD-UHFFFAOYSA-N |
| SMILES | C1(N)=NC(Cl)=CC(N)=[N+]1[O-] |
| LogP | 0.18-0.46 |
| CAS DataBase Reference | 35139-67-4(CAS DataBase Reference) |
Description and Uses
6-Chloro-pyrimidine-2,4-diamine 3-Oxide (Minoxidil EP Impurity A) is an impurity of the antihypertensive and antialopecia agent Minoxidil (M345000).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
