PRODUCT Properties
| Melting point: | 192-194°C | 
                                    
| Density | 1.92 g/cm3 | 
                                    
| vapor pressure | Negligible at 20 °C | 
                                    
| Flash point: | 138 °C | 
                                    
| storage temp. | APPROX 4°C | 
                                    
| solubility | DMSO: 1 mg/mL (1.51 mM); Water: < 0.1 mg/mL (insoluble) | 
                                    
| Water Solubility | 6-20 mgl-1 (20 °C) | 
                                    
| form | Solid:particulate/powder | 
                                    
| color | Light yellow to yellow | 
                                    
| Merck | 13,5738 | 
                                    
| InChI | InChI=1S/C4H8N2S4.Mn.Zn/c5-3(7)9-1-2-10-4(6)8;;/h1-2H2,(H2,5,7)(H2,6,8);; | 
                                    
| InChIKey | MSUOKLCPGNJGFW-UHFFFAOYSA-N | 
                                    
| SMILES | [Zn].[Mn].C(SC(=S)N)CSC(=S)N | 
                                    
| LogP | 1.8-2.3 at 20℃ and pH6-10 | 
                                    
| Dissociation constant | 12.09 at 20℃ | 
                                    
| CAS DataBase Reference | 8018-01-7(CAS DataBase Reference) | 
                                    
| EPA Substance Registry System | Mancozeb (8018-01-7) | 
                                    
Description and Uses
Mancozeb is a fungicide of the ethylene-bis-dit-hiocarbamate group. It is present in Rondo-M with pyrifenox. Occupational exposure occurs mainly in agricultural workers, in vineyard workers or in florists.
Fungicide.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS08,GHS07,GHS09  | 
                                    
| Signal word | Danger | 
| Hazard statements | H317-H351-H360D-H373-H410 | 
| Precautionary statements | P261-P272-P280-P302+P352-P333+P313-P321-P363-P501-P201-P202-P281-P308+P313-P405-P501-P260-P314-P501-P273-P391-P501 | 
| Hazard Codes | Xi,N,Xn | 
| Risk Statements | 37-43-50-63 | 
| Safety Statements | 8-24/25-46-61-36/37 | 
| RIDADR | UN 2210 | 
| RTECS | ZB3200000 | 
| HazardClass | 9 | 
| PackingGroup | III | 
| HS Code | 29309090 | 
| Hazardous Substances Data | 8018-01-7(Hazardous Substances Data) | 
| Toxicity | LC50 (48-hour) for carp 4.0 mg/L (Hartley and Kidd, 1987), catfish 5.2 mg/L, goldfish 9.0 mg/L (21°C) and rainbow trout 2.2 mg/L (17°C) (Worthing and Hance, 1991); acute oral LD50 for rats >8,000 mg/kg (Hartley and Kidd, 1987), mouse 600 mg/kg (RTECS, 1985). | 







