PRODUCT Properties
| Melting point: | 164-166°C |
| alpha | D25 +25° (in chloroform) |
| Boiling point: | 368.77°C (rough estimate) |
| Density | 1.0655 (rough estimate) |
| refractive index | 1.4709 (estimate) |
| storage temp. | Controlled Substance, -20°C Freezer |
| solubility | DMF: 25 mg/ml; DMSO: 15 mg/ml; DMSO:PBS (pH 7.2) (1:1): 0.5 mg/ml; Ethanol: 10 mg/ml |
| pka | 15.05±0.60(Predicted) |
| form | A crystalline solid |
| Water Solubility | 57.1mg/L at 20℃ |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChI | InChI=1/C19H26O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h7,9,11,14-17,21H,3-6,8,10H2,1-2H3/t14-,15-,16-,17-,18-,19-/s3 |
| InChIKey | RSIHSRDYCUFFLA-KRHBYBJCNA-N |
| SMILES | [C@@]12([H])CCC3=CC(=O)C=C[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@H](CC[C@@]21[H])O |&1:0,10,12,16,18,21,r| |
| CAS DataBase Reference | 846-48-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Boldenone(846-48-0) |
Description and Uses
Boldenone (Item No. 15432) is an analytical reference standard categorized as an anabolic androgenic steroid. Anabolic steroids, including boldenone, have been used to enhance physical performance in athletes. Boldenone is regulated as a Schedule III compound in the United States. This product is intended for research and forensic applications.
Boldenone is an anabolic steroid. Controlled substance.
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Danger |
| Hazard statements | H412-H362-H351-H360 |
| Precautionary statements | P201-P260-P263-P264-P270-P308+P313-P201-P202-P281-P308+P313-P405-P501-P273-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | F,Xn |
| Risk Statements | 11-20/21/22-36 |
| Safety Statements | 16-36/37 |
| WGK Germany | WGK 3 |
| RTECS | BV7994400 |
| HS Code | 29372900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Chronic 3 Carc. 2 Lact. Repr. 1A |
