M9666134
                    BUPIVACAINEHYDROCHLORIDE , 99% , 14252-80-3
                            Synonym(s):
1-Butyl-N-(2,6-dimethylphenyl)-2-piperidinecarboxamide;1-Butyl-N-(2,6-dimethylphenyl)-2-piperidinecarboxamide hydrochloride hydrate;Bupivacaine hydrochloride monohydrate
                            
                        
                CAS NO.:14252-80-3
Empirical Formula: C18H28N2O.ClH
Molecular Weight: 324.89
MDL number: MFCD00941462
EINECS: 627-065-3
| Pack Size | Price | Stock | Quantity | 
| 1g | RMB31.20 | In Stock | 
                                                 | 
                                        
| 5g | RMB100.80 | In Stock | 
                                                 | 
                                        
| 25g | RMB350.40 | In Stock | 
                                                 | 
                                        
| 100g | RMB1104.00 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 249-2510C | 
                                    
| storage temp. | Refrigerator | 
                                    
| solubility | Soluble in water, freely soluble in alcohol. | 
                                    
| form | Solid | 
                                    
| color | White to Off-White | 
                                    
| Stability: | Hygroscopic | 
                                    
| InChI | InChI=1S/C18H28N2O.ClH/c1-4-5-12-20-13-7-6-11-16(20)18(21)19-17-14(2)9-8-10-15(17)3;/h8-10,16H,4-7,11-13H2,1-3H3,(H,19,21);1H | 
                                    
| InChIKey | SIEYLFHKZGLBNX-UHFFFAOYSA-N | 
                                    
| SMILES | C1(CCCCN1CCCC)C(=O)NC1C(C)=CC=CC=1C.Cl | 
                                    
| CAS DataBase Reference | 14252-80-3(CAS DataBase Reference) | 
                                    
Description and Uses
Bupivacaine Hydrochloride is the salt form of Bupivacaine (B689561); is a sodium channel blocker, local anesthetic.
Safety
| Symbol(GHS) | ![]() GHS06  | 
                                    
| Signal word | Danger | 
| Hazard statements | H330-H300-H310 | 
| Precautionary statements | P264-P270-P301+P310-P321-P330-P405-P501-P260-P271-P284-P304+P340-P310-P320-P403+P233-P405-P501-P262-P264-P270-P280-P302+P350-P310-P322-P361-P363-P405-P501 | 
| Hazard Codes | T+ | 
| Risk Statements | 26/27/28 | 
| Safety Statements | 22-36/37/39-45 | 
| RIDADR | UN 2811 6.1/PG 2 | 
| WGK Germany | 3 | 
| RTECS | TK6125000 | 
| HazardClass | 6.1(b) | 
| PackingGroup | III | 
| HS Code | 2933399090 | 
| Toxicity | LD50 in mice (mg/kg): 7.8 i.v., 82 s.c. (Henn, Brattsand) | 




