PRODUCT Properties
| Melting point: | 197-202°C |
| Boiling point: | 835.4±65.0 °C(Predicted) |
| Density | 1.664±0.06 g/cm3(Predicted) |
| storage temp. | 4°C, protect from light |
| solubility | DMSO: soluble |
| form | A crystalline solid |
| pka | 6.92±0.40(Predicted) |
| color | Light yellow to yellow |
| InChIKey | XGEYXJDOVMEJNG-UOWIVAOKNA-N |
| SMILES | [C@@H]1([C@H](O)[C@H]([C@H](O)[C@@H](CO)O1)O)OC1C=CC(C(=O)/C=C/C2C=CC(O)=C(O)C=2)=C(O)C=1O |&1:0,1,3,4,6,r| |
| LogP | -0.180 (est) |
Description and Uses
Marein has the neuroprotective effect due to a reduction of damage to mitochondria function and activation of the AMPK signal pathway. Marein improves insulin resistance induced by high glucose in HepG2 cells through CaMKK/AMPK/GLUT1 to promote glucose uptake, through IRS/Akt/GSK-3β to increase glycogen synthesis, and through Akt/FoxO1 to decrease gluconeogenesis. Marein is a HDAC inhibitor with an IC50 of 100 μM. Marein has beneficial antioxidative, antihypertensive, antihyperlipidemic and antidiabetic effects[1][2][3].
Safety
| Hazard Codes | Xi |
