M9823034
Bis(4-octylphenyl)amine , 98% , 101-67-7
CAS NO.:101-67-7
Empirical Formula: C28H43N
Molecular Weight: 393.65
MDL number: MFCD00048942
EINECS: 202-965-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB91.20 | In Stock |
|
| 1g | RMB268.80 | In Stock |
|
| 5g | RMB780.80 | In Stock |
|
| 25g | RMB2256.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 96-97°C |
| Boiling point: | 508.06°C (rough estimate) |
| Density | 1.0937 (rough estimate) |
| refractive index | 1.9470 (estimate) |
| storage temp. | -20°C Freezer |
| solubility | DMSO: Sparingly soluble: 1-10 mg/mL Ethanol: Slightly soluble: 0.1-1 mg/mL |
| pka | 1.61±0.50(Predicted) |
| form | Solid |
| Water Solubility | <0.1 g/100 mL at 21 ºC |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C28H43N/c1-3-5-7-9-11-13-15-25-17-21-27(22-18-25)29-28-23-19-26(20-24-28)16-14-12-10-8-6-4-2/h17-24,29H,3-16H2,1-2H3 |
| InChIKey | QAPVYZRWKDXNDK-UHFFFAOYSA-N |
| SMILES | C1(NC2=CC=C(CCCCCCCC)C=C2)=CC=C(CCCCCCCC)C=C1 |
| CAS DataBase Reference | 101-67-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Diphenylamine, 4,4'-dioctyl-(101-67-7) |
| EPA Substance Registry System | 4,4'-Dioctyldiphenylamine (101-67-7) |
Description and Uses
Bis(4-octylphenyl)amine is an additive. It is used for preparing plasticized neoprene rubber compounds.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Risk Statements | 20/21/22 |
| Safety Statements | 26-36/37/39 |
| TSCA | TSCA listed |
| Hazardous Substances Data | 101-67-7(Hazardous Substances Data) |






