MR0786758
97% , 22466-49-5
Synonym(s):
Sodium 1,1,1,5,5,5-hexafluoroacetylacetonate;Sodium hexafluoroacetylacetonate;Sodium hexafluoroacetylacetone
| Pack Size | Price | Stock | Quantity |
| 5g | RMB1604.80 | In Stock |
|
| 25g | RMB6303.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 230°C (dec.) |
| form | Powder |
| color | white |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| Stability: | hygroscopic |
| InChI | 1S/C5H2F6O2.Na/c6-4(7,8)2(12)1-3(13)5(9,10)11;/h1,12H;/q;+1/p-1/b2-1-; |
| InChIKey | AWUDPEKDPFGDOP-ODZAUARKSA-M |
| SMILES | [Na+].[O-]\C(=C/C(=O)C(F)(F)F)C(F)(F)F |
Description and Uses
Recently employed in the solid-phase synthesis of chromium β-diketonates, in the preparation of novel catalytic ruthenium diphosphine complexes and in the preparation of a series of new copper chemical vapor deposition (CVD) precursors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | No |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
