MR6755056
98% , 20183-47-5
| Pack Size | Price | Stock | Quantity |
| 20mg | RMB652.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 201-204℃ |
| Boiling point: | 853.6±65.0 °C(Predicted) |
| Density | 1.39 |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | DMSO (Slightly), Methanol (Slightly), Pyridine (Slightly) |
| pka | 4.15±0.70(Predicted) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | slightly soluble in water |
| Stability: | Hygroscopic |
| Major Application | food and beverages |
| InChIKey | DBJLNNAUDGIUAE-YRAPYSFMNA-N |
| SMILES | O1[C@H]([C@@H]([C@H]([C@@H]([C@H]1CO)O)O)O)OC2[C@@](C3[C@@](C4[C@]([C@@]5(CCC6(C(CC(CC6)(C)C)C5=CC4)C(=O)O)CO)(CC3)C)(CC2O)C)(C)C(=O)O |
Description and Uses
Tenuifolin is a terpenoid with potential to treat Alzheimer’s disease.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | WGK 3 |
| HS Code | 29389090 |
| Storage Class | 11 - Combustible Solids |





