MR6778356
98% , 32791-84-7
| Pack Size | Price | Stock | Quantity |
| 20mg | RMB139.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 238-239 °C |
| Boiling point: | 561.5±50.0 °C(Predicted) |
| Density | 1.068±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), DMSO (Slightly) |
| form | Solid |
| pka | 14.70±0.70(Predicted) |
| color | White |
| InChIKey | QFJUYMMIBFBOJY-UXZRXANASA-N |
| SMILES | O1[C@](CCCC1(C)C)([C@@H]2[C@@H]3[C@]([C@]4([C@@H]([C@@]5([C@@H]([C@@H](C4)O)C([C@H](CC5)O)(C)C)C)C[C@H]3O)C)(CC2)C)C |
Description and Uses
Panaxatriol is used in biological studies as sources of new bifunctional scaffolds targeting cholinesterases and beta amyloid aggregation.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| Safety Statements | 24/25 |
| WGK Germany | WGK 3 |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
