MR6910956
Analysis standard , 69806-34-4
Synonym(s):
2-[4-[[3-Chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoic acid;Haloxyfop acid
CAS NO.：69806-34-4
Empirical Formula: C15H11ClF3NO4
Molecular Weight: 361.7
MDL number: MFCD00871401
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB197.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 107.5 °C |
| Boiling point: | 420.3±45.0 °C(Predicted) |
| Density | 1.442±0.06 g/cm3(Predicted) |
| storage temp. | 0-6°C |
| solubility | DMSO : 100 mg/mL (276.47 mM; Need ultrasonic) |
| form | Solid |
| pka | 3.12±0.10(Predicted) |
| color | White to off-white |
| BRN | 1507817 |
| Major Application | agriculture environmental |
| InChI | 1S/C15H11ClF3NO4/c1-8(14(21)22)23-10-2-4-11(5-3-10)24-13-12(16)6-9(7-20-13)15(17,18)19/h2-8H,1H3,(H,21,22) |
| InChIKey | GOCUAJYOYBLQRH-UHFFFAOYSA-N |
| SMILES | CC(Oc1ccc(Oc2ncc(cc2Cl)C(F)(F)F)cc1)C(O)=O |
| CAS DataBase Reference | 69806-34-4(CAS DataBase Reference) |
| EPA Substance Registry System | Haloxyfop (69806-34-4) |
Description and Uses
(±)-Haloxyfop is a herbicide.
Safety
| Symbol(GHS) |   GHS07,GHS05 |
| Signal word | Danger |
| Hazard statements | H302-H318-H412 |
| Precautionary statements | P273-P501-P264-P270-P301+P312-P330-P501-P280-P305+P351+P338-P310 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| RTECS | UA2458284 |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 Eye Dam. 1 |
