MR7996556
HPLC＞98% , 129025-96-3
| Pack Size | Price | Stock | Quantity |
| 20mg | RMB3308.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 845.0±65.0 °C(Predicted) |
| Density | 1.602±0.06 g/cm3(Predicted) |
| pka | 5.92±0.20(Predicted) |
| form | Solid |
| color | Yellow to brown |
| InChIKey | LQYQYAJWKXDTHR-XVDJCIDHNA-N |
| SMILES | C1(O)=C2C(C(=O)C3=C(C2=O)C(OC)=C(O)C(C)=C3)=CC(O[C@H]2[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O2)=C1OC |&1:21,22,24,26,28,r| |
Description and Uses
Glucoaurantio-obtusin can be used to determine the effects of ethanol toxicity of Cassia tora L seeds in rats. It can also be used to identify the effect on mercury-induced toxicity.
