MR8210356
95%,stabilizedwith5%K2CO3 , 2746-25-0
CAS NO.:2746-25-0
Empirical Formula: C8H9BrO
Molecular Weight: 201.06
MDL number: MFCD00800380
EINECS: 608-101-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB50.40 | In Stock |
|
| 5g | RMB125.60 | In Stock |
|
| 25g | RMB350.40 | In Stock |
|
| 100g | RMB997.60 | In Stock |
|
| 500g | RMB4482.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 240 °C |
| Boiling point: | 91 °C1 mm Hg(lit.) |
| Density | 1.379 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| form | liquid |
| color | Faintly hazy, faint yellow |
| InChI | InChI=1S/C8H9BrO/c1-10-8-4-2-7(6-9)3-5-8/h2-5H,6H2,1H3 |
| InChIKey | GIGRWGTZFONRKA-UHFFFAOYSA-N |
| SMILES | C1(CBr)=CC=C(OC)C=C1 |
| CAS DataBase Reference | 2746-25-0(CAS DataBase Reference) |
Description and Uses
4-Methoxybenzyl Bromide is a useful reactant in studying diarylpyrazoles as cyclooxygenase 2 inhibitors.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P422 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 1 |
| HazardClass | 8 |
| HS Code | 29093090 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |





