S0396616
(1R,2S,5R)-(+)-5-Methyl-2-(1-methyl-1-phenylethyl)cyclohexyl chloroacetate , 99% , 71804-27-8
Synonym(s):
(+)-8-Phenylmenthyl chloroacetate
| Pack Size | Price | Stock | Quantity |
| 1g | RMB709.63 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 82-84 °C (lit.) |
| Boiling point: | 385.281±15.00 °C(Press: 760.00 Torr)(predicted) |
| Density | 1.084±0.10 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) |
| form | solid |
| optical activity | [α]25/D +22°, c = 1.2 in carbon tetrachloride |
| InChI | 1S/C18H25ClO2/c1-13-9-10-15(16(11-13)21-17(20)12-19)18(2,3)14-7-5-4-6-8-14/h4-8,13,15-16H,9-12H2,1-3H3/t13-,15-,16-/m1/s1 |
| InChIKey | GYWWQECFQIGECM-FVQBIDKESA-N |
| SMILES | C[C@@H]1CC[C@H]([C@@H](C1)OC(=O)CCl)C(C)(C)c2ccccc2 |
Description and Uses
(1R,2S,5R)-(+)-5-Methyl-2-(1-methyl-1-phenylethyl)cyclohexyl chloroacetate may be used in the synthesis of (-)-8-phenyl-menthol, (+)-8-phenylmenthyl isocyanoacetate and (+)-cularine.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H319-H315 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |





