S0405016
2,3,5,6-Tetrafluoro-4-(trifluoromethyl)benzyl bromide , 98% , 76437-40-6
Synonym(s):
1-(Bromomethyl)-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene;4-(Trifluoromethyl)-2,3,5,6-tetrafluorobenzyl bromide
| Pack Size | Price | Stock | Quantity |
| 1g | RMB769.32 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 190.0±35.0 °C(Predicted) |
| Density | 1.864 g/mL at 25 °C (lit.) |
| vapor pressure | 0.38 psi ( 20 °C) |
| refractive index | n |
| Flash point: | 210 °F |
| form | liquid |
| color | Clear |
| Sensitive | Lachrymatory |
| BRN | 8423469 |
| InChI | InChI=1S/C8H2BrF7/c9-1-2-4(10)6(12)3(8(14,15)16)7(13)5(2)11/h1H2 |
| InChIKey | WKPYRDRWTNJBQI-UHFFFAOYSA-N |
| SMILES | C1(CBr)=C(F)C(F)=C(C(F)(F)F)C(F)=C1F |
Description and Uses
2,3,5,6-Tetrafluoro-4-(trifluoromethyl)benzyl bromide (4-(trifluoromethyl)-2,3,5,6-tetrafluorobenzyl bromide, TTBB) may be employed as an alternate of pentafluorobenzyl bromide (PFBB) in electrophoric derivatization reactions prior to detection during gas chromatography-electron-capture negative ion mass spectrometry (GC-ECNI-MS). TTBB may be employed as derivatization reagent for the characterization and quantitation of DNA and hemoglobin adducts.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C,Xi |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| F | 19 |
| Hazard Note | Harmful/Lachrymatory |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |







