S0448116
inherentviscosity~1.2dl/g , 106989-11-1
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB830.78 | In Stock |
|
| 500MG | RMB2584.55 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 154 °C |
| storage temp. | 2-8°C |
| InChI | InChI=1/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6)/t2-/s3 |
| InChIKey | JVTAAEKCZFNVCJ-NVFNTWQMNA-N |
| SMILES | [C@@H](O)(C)C(=O)O |&1:0,r| |
Description and Uses
Poly(D-lactide) (PDLA), a polymer of a stereospecific cyclic di-ester of lactic acid, is used in biomaterial research for the development of devices such as therapeutic drug delivery vessels. Poly(D-lactide) is used for the preparation of microparticles and resorbable polylactide scaffolds.
Safety
| WGK Germany | 3 |
| F | 10-21 |
