![Bis[4-(glycidyloxy)phenyl]methane](https://img.chemicalbook.com/CAS/GIF/2095-03-6.gif)
S0530416
Bis[4-(glycidyloxy)phenyl]methane , mixtureofisomers , 2095-03-6
Synonym(s):
BFDGE;Bisphenol F diglycidyl ether
CAS NO.：2095-03-6
Empirical Formula: C19H20O4
Molecular Weight: 312.36
MDL number: MFCD00799483
EINECS: 218-257-4
| Pack Size | Price | Stock | Quantity |
| 100ml | RMB1253.94 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | −15 °C(lit.) |
| Boiling point: | 474.0±25.0 °C(Predicted) |
| Density | 1.19 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), DMSO (Slightly) |
| form | Solid |
| color | White to Off-White |
| BRN | 5349017 |
| InChI | InChI=1S/C19H20O4/c1-5-16(20-10-18-12-22-18)6-2-14(1)9-15-3-7-17(8-4-15)21-11-19-13-23-19/h1-8,18-19H,9-13H2 |
| InChIKey | XUCHXOAWJMEFLF-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(OCC2CO2)C=C1)C1=CC=C(OCC2CO2)C=C1 |
| EPA Substance Registry System | Oxirane, 2,2'-[methylenebis(4,1-phenyleneoxymethylene)]bis- (2095-03-6) |
Description and Uses
Bisphenol F Diglycidyl Ether is an novalac glycidyl ether (NOGE). Bisphenol F Diglycidyl Ether is found in resin used as coatings for food cans. Bisphenol F Diglycidyl Ether is a toxic conatminant wit h strict limitations on the amount allowed in food products.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H317-H319-H335-H410 |
| Precautionary statements | P261-P264-P273-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,N |
| Risk Statements | 36/38-43-50/53-36/37/38 |
| Safety Statements | 37/39-61-60-36/37-26 |
| RIDADR | UN 3082 9/PG 3 |
| WGK Germany | 3 |
