S0786116
5,5-Diphenyl-2-thiohydantoin , 99% , 21083-47-6
Synonym(s):
5,5-Diphenyl-2-thioxo-4-imidazolidinone;5,5-Diphenylimidazolidine-4-one-2-thione;DPTH
CAS NO.:21083-47-6
Empirical Formula: C15H12N2OS
Molecular Weight: 268.33
MDL number: MFCD00005278
EINECS: 244-201-3
| Pack Size | Price | Stock | Quantity |
| 5g | RMB691.96 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 237-239 °C (lit.) |
| Boiling point: | 204°C (rough estimate) |
| Density | 1.2127 (rough estimate) |
| refractive index | 1.7400 (estimate) |
| pka | 7.52±0.50(Predicted) |
| form | powder |
| InChI | 1S/C15H12N2OS/c18-13-15(17-14(19)16-13,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H,(H2,16,17,18,19) |
| InChIKey | AMDPNECWKZZEBQ-UHFFFAOYSA-N |
| SMILES | O=C1NC(=S)NC1(c2ccccc2)c3ccccc3 |
| CAS DataBase Reference | 21083-47-6 |
| EPA Substance Registry System | 4-Imidazolidinone, 5,5-diphenyl-2-thioxo- (21083-47-6) |
Description and Uses
5,5-Diphenyl-2-thiohydantoin is a reactant for synthesis of imidazole derivatives.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36 |
| WGK Germany | 3 |
| RTECS | MU1750000 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |






