PRODUCT Properties
| storage temp. | -20°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| Stability: | Hygroscopic |
| Major Application | forensics and toxicology |
| InChI | 1S/C15H23NO2.ClH/c1-16-11-13-6-3-4-9-15(13,17)12-7-5-8-14(10-12)18-2;/h5,7-8,10,13,16-17H,3-4,6,9,11H2,1-2H3;1H/t13-,15+;/m1./s1/i1D3; |
| InChIKey | NOZLWRHUQJHIRG-UOYBXXRGSA-N |
| SMILES | O[C@@]1(CCCC[C@@H]1CNC([2H])([2H])[2H])C2=CC(OC)=CC=C2.[H]Cl |
Description and Uses
A labelled metabolite of Tramadol.
Safety
| Symbol(GHS) |    GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H301+H311+H331-H370 |
| Precautionary statements | P210-P280-P301+P310+P330-P302+P352+P312-P304+P340+P311 |
| target organs | Eyes |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | WGK 2 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |