PRODUCT Properties
| Flash point: | 9℃ |
| storage temp. | -20°C |
| solubility | DMF: 3 mg/ml,DMSO: 10 mg/ml,Ethanol: 10 mg/ml,PBS (pH 7.2): 0.5 mg/ml |
| form | A crystalline solid |
| color | White to off-white |
| Major Application | clinical testing |
| InChI | 1S/C19H23ClN2.ClH/c1-21(2)12-5-13-22-18-7-4-3-6-15(18)8-9-16-10-11-17(20)14-19(16)22;/h3-4,6-7,10-11,14H,5,8-9,12-13H2,1-2H3;1H/i1D3; |
| InChIKey | WIMWMKZEIBHDTH-NIIDSAIPSA-N |
| SMILES | Clc1cc2c(cc1)CCc3c(cccc3)N2CCCN(C([2H])([2H])[2H])C.Cl |
Description and Uses
Labeled Clomipramine, intended for use as an internal standard for the quantification of Clomipramine by GC- or LC-mass spectrometry.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H301+H311+H331-H370 |
| Precautionary statements | P210-P260-P280-P301+P310-P311 |
| target organs | Eyes |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | 1 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |




