PRODUCT Properties
| Boiling point: | 84.4 °C (lit.) |
| Density | 1.078 g/mL at 25 °C |
| refractive index | n |
| Flash point: | 9 °F |
| solubility | Acetone (Slightly), Chloroform (Slightly), DMSO (Slightly) |
| form | Oil |
| color | Colourless |
| Stability: | Volatile |
| InChI | 1S/C6H5F/c7-6-4-2-1-3-5-6/h1-5H/i1D,2D,3D,4D,5D |
| InChIKey | PYLWMHQQBFSUBP-RALIUCGRSA-N |
| SMILES | [2H]c1c([2H])c([2H])c(F)c([2H])c1[2H] |
| CAS Number Unlabeled | 462-06-6 |
Description and Uses
Fluorobenzene-d4 is the isotope labelled analog of Fluorobenzene, which is an aryl fluorinated building block used in various chemical synthesis. Fluorobenzene is a useful solvent for highly reactive species.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H315-H319-H335 |
| Precautionary statements | P210-P233-P240-P241-P303+P361+P353-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | F,Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 16-26-36 |
| RIDADR | UN 2387 3/PG 2 |
| WGK Germany | 2 |
| RTECS | DA0800000 |
| HS Code | 2845901000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |








