S0849049
9-Hydroxyrisperidone-D4solution , 100?μg/mLinmethanol,ampuleof1?mL,certifiedreferencematerial,Cerilliant? , 1020719-55-4
CAS NO.:1020719-55-4
Empirical Formula: C23H27FN4O3
Molecular Weight: 426.484
MDL number: MFCD09955571
EINECS: 200-659-6
| Pack Size | Price | Stock | Quantity |
| 1mL | RMB2624.41 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 158-160°C |
| Flash point: | 9℃ |
| storage temp. | -20°C Freezer |
| solubility | Chloroform: slightly soluble,DMSO: slightly soluble,Methanol: slightly soluble |
| form | A solid |
| color | White to off-white |
| Major Application | clinical testing |
| InChI | InChI=1S/C23H27FN4O3/c1-14-17(23(30)28-9-2-3-19(29)22(28)25-14)8-12-27-10-6-15(7-11-27)21-18-5-4-16(24)13-20(18)31-26-21/h4-5,13,15,19,29H,2-3,6-12H2,1H3 |
| InChIKey | PMXMIIMHBWHSKN-UHFFFAOYSA-N |
| SMILES | C1C(O)C2=NC(C)=C(CCN3CCC(c4c5ccc(F)cc5on4)CC3)C(=O)N2CC1 |w:1,r| |
Description and Uses
RAC 9-HYDROXYRISPERIDONE-D4 is a deuterated analog of Paliperidone, a combined serotonin (5-HT2) and dopamine (D2) receptor antagonist
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02, GHS06, GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H301+H311+H331-H370 |
| Precautionary statements | P210-P260-P280-P301+P310-P311 |
| target organs | Eyes |
| Hazard Codes | F,T |
| Risk Statements | 11-23/24/25-39/23/24/25 |
| Safety Statements | 7-16-36/37-45 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | 1 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |






![3-(2-Chloroethyl)-6,7,8,9-tetrahydro-9-hydroxy-2-methyl-4H-pyrido[1,2-a]pyrimidine-4-one](https://img.chemicalbook.com/CAS/GIF/130049-82-0.gif)


