S0917549
Sodiumxylenesulfonate , technical,mixtureofisomers,≥90%(T) , 1300-72-7
Synonym(s):
Dimethylbenzenesulfonic acid sodium salt;Xylenesulfonic acid sodium salt
CAS NO.：1300-72-7
Empirical Formula: C8H9NaO3S
Molecular Weight: 208.21
MDL number: MFCD00007513
EINECS: 215-090-9
| Pack Size | Price | Stock | Quantity |
| 1kg | RMB967.38 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 27°C |
| Boiling point: | 157°C |
| Density | 1.17 g/mL at 25 °C |
| refractive index | n |
| solubility | Methanol (Slightly, Heated), Water (Slightly) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | >=10 g/100 mL at 20 ºC |
| Stability: | Stable. Combustible. Incompatible with acids, oxidizing agents. Moisture-sensitive. |
| Cosmetics Ingredients Functions | SURFACTANT - HYDROTROPE |
| InChI | InChI=1S/C8H10O3S.Na/c1-6-3-4-8(5-7(6)2)12(9,10)11;/h3-5H,1-2H3,(H,9,10,11);/q;+1/p-1 |
| InChIKey | QUCDWLYKDRVKMI-UHFFFAOYSA-M |
| SMILES | S([O-])(=O)(=O)C1C=CC(C)=C(C)C=1.[Na+] |
| LogP | 1.390 (est) |
| CAS DataBase Reference | 1300-72-7(CAS DataBase Reference) |
| EPA Substance Registry System | Sodium xylenesulfonate (1300-72-7) |
Description and Uses
Sodium xylenesulfonate solution may be used in chemical synthesis studies.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-36 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 1 |
| RTECS | ZE5100000 |
| Hazardous Substances Data | 1300-72-7(Hazardous Substances Data) |
