PRODUCT Properties
| Melting point: | 250-253 °C(lit.) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | ≥68 mg/mL in DMSO; ≥10.68 mg/mL in H2O; ≥4.57 mg/mL in EtOH |
| form | solid |
| color | White to off-white |
| optical activity | [α]20/D +116°, c = 1% in ethanol |
| InChIKey | SFPGJACKHKXGBH-BISAGJBCNA-N |
| SMILES | C12[C@@H]3N(CCC=1C=C(OC)C(OC)=C2OC1C(OC)=CC2CCN(C)[C@@H](CC4C=CC(=CC=4)OC4=C(O)C=CC(=C4)C3)C=2C=1)C.Cl |&1:1,25,r| |
Description and Uses
(+)-Berbamine Dihydrochloride exerts anti-inflammatory effects through inhibition of NF-κB and MAPK signalling pathways.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
