S097679
Dibenz [b,f]azepine-5-carbonyl chloride , 90% , 33948-22-0
CAS NO.:33948-22-0
Empirical Formula: C15H10ClNO
Molecular Weight: 255.7
MDL number: MFCD00792462
EINECS: 412-100-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB654.52 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 149-153 °C (lit.) |
| Boiling point: | 413.7±38.0 °C(Predicted) |
| Density | 1.316±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | soluble in Chloroform, Dichloromethane, Ethyl Acetate |
| form | Oil |
| pka | -3.69±0.20(Predicted) |
| color | Brown |
| InChI | InChI=1S/C15H10ClNO/c16-15(18)17-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)17/h1-10H |
| InChIKey | APJYHXJGXDPGBA-UHFFFAOYSA-N |
| SMILES | C(Cl)(N1C2=CC=CC=C2C=CC2=CC=CC=C12)=O |
| CAS DataBase Reference | 33948-22-0(CAS DataBase Reference) |
Description and Uses
An intermediate in the preparation of Carbamazepine.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |

![Dibenz [b,f]azepine-5-carbonyl chloride](https://img.chemicalbook.com/CAS/GIF/33948-22-0.gif)


