S1267416
≥98%(HPLC) , 176977-56-3
Synonym(s):
[6-Methoxy-2-(4-methoxyphenyl)benzo[b]furan-3-yl](4-cyanophenyl)methanone;4-[6-Methoxy-2-(4-methoxyphenyl)benzofuran-3-carbonyl]benzonitrile;LY320135
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB1066.02 | In Stock |
|
| 25mg | RMB4297.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 617.2±55.0 °C(Predicted) |
| Density | 1.31±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO: ≥10mg/mL |
| form | powder |
| color | orange |
| InChI | 1S/C24H17NO4/c1-27-18-9-7-17(8-10-18)24-22(20-12-11-19(28-2)13-21(20)29-24)23(26)16-5-3-15(14-25)4-6-16/h3-13H,1-2H3 |
| InChIKey | RYNSGDFWBJWWSZ-UHFFFAOYSA-N |
| SMILES | COc1ccc(cc1)-c2oc3cc(OC)ccc3c2C(=O)c4ccc(cc4)C#N |
Description and Uses
[6-Methoxy-2-(4-methoxyphenyl)benzo[b]furan-3-yl](4-cyanophenyl)methanone is a selective antagonist for the brain CB1 receptor, having greater than 70-fold higher affinity for the CB1 than the periphe ral CB2 receptor. [6-Methoxy-2-(4-methoxyphenyl)benzo[b]furan-3-yl](4-cyanophenyl)methanone is a promising lead compound for the further development of selective cannabinoid antagonists of novel struc ture.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310 |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
