PRODUCT Properties
| Melting point: | 53-54℃ |
| Boiling point: | 65 °C |
| Density | 0.951 g/mL at 25 °C |
| Flash point: | <1 °F |
| storage temp. | 2-8°C |
| InChI | InChI=1S/C8H10N.BrH.Mg/c1-9(2)8-6-4-3-5-7-8;;/h4-7H,1-2H3;1H;/q;;+1/p-1 |
| InChIKey | OWWWKAXERYRWAU-UHFFFAOYSA-M |
| SMILES | C1(N(C)C)C=CC([Mg]Br)=CC=1 |
Description and Uses
Bromo(4-(dimethylamino)phenyl)magnesium is used in preparation of Penta-deuterium-substituted Malachite green salt.It is used in preparation of Triaryl Phosphine ligands and use in catalyzing coupling reactions.
Safety
| Symbol(GHS) |     GHS02,GHS05,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H302-H314-H335-H351 |
| Precautionary statements | P210-P260-P280-P305+P351+P338-P370+P378-P403+P235 |
| Hazard Codes | F,C |
| Risk Statements | 11-14-19-22-34-40-37 |
| Safety Statements | 16-23-26-36/37/39-45 |
| RIDADR | UN 2924 3/PG 2 |
| WGK Germany | 1 |
| HazardClass | 3, 8 |
| HS Code | 2921410090 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
