S1365116
≥98%(HPLC) , 134575-17-0
Synonym(s):
MN-2633;N-(1a,5a,6a)-3-Azabicyclo[3.1.0]hex-6-yl-carbamic acid 1,1-dimethylethyl ester;PF-3339644
CAS NO.:134575-17-0
Empirical Formula: C10H18N2O2
Molecular Weight: 198.26
MDL number: MFCD10698578
EINECS: 429-170-8
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB1257.65 | In Stock |
|
| 25mg | RMB5015.72 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 110-111°C |
| Boiling point: | 305.3±31.0 °C(Predicted) |
| Density | 1.11±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO: >20mg/mL |
| pka | 12.39±0.20(Predicted) |
| form | powder |
| color | white to off-white |
| InChI | InChI=1S/C10H18N2O2/c1-10(2,3)14-9(13)12-8-6-4-11-5-7(6)8/h6-8,11H,4-5H2,1-3H3,(H,12,13) |
| InChIKey | QIYOMZXJQAKHEK-UHFFFAOYSA-N |
| SMILES | C(OC(C)(C)C)(=O)NC1C2C1CNC2 |
Description and Uses
An intermediate of Trovafloxacin (T893000) and analogs.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H317-H318-H373 |
| Precautionary statements | P260-P280-P301+P312-P302+P352-P305+P351+P338-P314 |
| Hazard Codes | Xn |
| Risk Statements | 22-41-43-48/22 |
| Safety Statements | 22-26-36/37/39 |
| WGK Germany | 3 |









