PRODUCT Properties
| Melting point: | -6°C |
| Boiling point: | 230-231 °C(lit.) |
| Density | 1.044 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 195 °F |
| InChI | InChI=1S/C9H10O/c1-2-5-8-6-3-4-7-9(8)10/h2-7,10H,1H3 |
| InChIKey | WHGXZPQWZJUGEP-GORDUTHDSA-N |
| SMILES | C1(O)=CC=CC=C1C=CC |
Description and Uses
2-Propenylphenol, a mixture of cis and trans, is extensively employed in chemical research. 2-Propenylphenol, a Mixture Of Cis And Trans, is studied for its ability to polymerize and develop new polymeric materials with specific mechanical and chemical properties. It is utilized to investigate the effects of geometric isomerism on organic compounds' physical and chemical behaviour. The mixture′s role in synthesising advanced organic molecules, particularly those with potential applications in high-performance coatings and adhesives, is also a significant area of study.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN 3145 8/PG 3 |
| WGK Germany | 3 |
| RTECS | SM8575000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




![3-[2-(Diethylamino)ethyl]-7-hydroxy-4-methylcoumarinhydrochloride](https://img.chemicalbook.com/CAS/GIF/15776-59-7.gif)
